C19H27ClN2O4 — CID 119325626
methyl 2-[3-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)methyl]phenoxy]acetate;hydrochloride (PubChem CID 119325626) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is methyl 2-[3-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)methyl]phenoxy]acetate;hydrochloride.
| Compound Name | methyl 2-[3-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)methyl]phenoxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 119325626 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | methyl 2-[3-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)methyl]phenoxy]acetate;hydrochloride |
| SMILES | COC(=O)COc1cccc(CNC(=O)C2CC3CCCCC3N2)c1.Cl |
| InChI | InChI=1S/C19H26N2O4.ClH/c1-24-18(22)12-25-15-7-4-5-13(9-15)11-20-19(23)17-10-14-6-2-3-8-16(14)21-17;/h4-5,7,9,14,16-17,21H,2-3,6,8,10-12H2,1H3,(H,20,23);1H |
| InChIKey | CABFERJAJGUWKM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |