C16H22N2O4 — CID 119325625
methyl 2-[3-[(piperidine-2-carbonylamino)methyl]phenoxy]acetate (PubChem CID 119325625) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl 2-[3-[(piperidine-2-carbonylamino)methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[(piperidine-2-carbonylamino)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 119325625 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl 2-[3-[(piperidine-2-carbonylamino)methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(CNC(=O)C2CCCCN2)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-21-15(19)11-22-13-6-4-5-12(9-13)10-18-16(20)14-7-2-3-8-17-14/h4-6,9,14,17H,2-3,7-8,10-11H2,1H3,(H,18,20) |
| InChIKey | DUHHRKSTOPGQRT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |