C15H20N2O5 — CID 119787113
methyl 2-[3-[[(4-hydroxypyrrolidine-2-carbonyl)amino]methyl]phenoxy]acetate (PubChem CID 119787113) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl 2-[3-[[(4-hydroxypyrrolidine-2-carbonyl)amino]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[(4-hydroxypyrrolidine-2-carbonyl)amino]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 119787113 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | methyl 2-[3-[[(4-hydroxypyrrolidine-2-carbonyl)amino]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(CNC(=O)C2CC(O)CN2)c1 |
| InChI | InChI=1S/C15H20N2O5/c1-21-14(19)9-22-12-4-2-3-10(5-12)7-17-15(20)13-6-11(18)8-16-13/h2-5,11,13,16,18H,6-9H2,1H3,(H,17,20) |
| InChIKey | OKJYAJIZSOFGTD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |