C21H26Cl2FN3O2 — CID 119870344
N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119870344) has the molecular formula C21H26Cl2FN3O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119870344 |
| Molecular Formula | C21H26Cl2FN3O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCc1ccc(Oc2cccc(F)c2)nc1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C21H24FN3O2.2ClH/c22-16-5-3-6-17(11-16)27-20-9-8-14(12-23-20)13-24-21(26)19-10-15-4-1-2-7-18(15)25-19;;/h3,5-6,8-9,11-12,15,18-19,25H,1-2,4,7,10,13H2,(H,24,26);2*1H |
| InChIKey | QUIZWXNQYICKNW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |