C17H18FN3O2 — CID 119870373
N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 119870373) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119870373 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Oc2cccc(F)c2)nc1)C1CCNC1 |
| InChI | InChI=1S/C17H18FN3O2/c18-14-2-1-3-15(8-14)23-16-5-4-12(9-20-16)10-21-17(22)13-6-7-19-11-13/h1-5,8-9,13,19H,6-7,10-11H2,(H,21,22) |
| InChIKey | YZUPEGMFLABBCM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |