C17H20FN3O2 — CID 60610934
1,1-diethyl-3-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]urea (PubChem CID 60610934) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 1,1-diethyl-3-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]urea.
| Compound Name | 1,1-diethyl-3-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 60610934 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1,1-diethyl-3-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]urea |
| SMILES | CCN(CC)C(=O)NCc1ccc(Oc2cccc(F)c2)nc1 |
| InChI | InChI=1S/C17H20FN3O2/c1-3-21(4-2)17(22)20-12-13-8-9-16(19-11-13)23-15-7-5-6-14(18)10-15/h5-11H,3-4,12H2,1-2H3,(H,20,22) |
| InChIKey | UOPQKLDLPSVHKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |