C16H20Cl2FN3O2 — CID 119870364
3-amino-N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]butanamide;dihydrochloride (PubChem CID 119870364) has the molecular formula C16H20Cl2FN3O2 and a molecular weight of 376.26 g/mol. Its IUPAC name is 3-amino-N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119870364 |
| Molecular Formula | C16H20Cl2FN3O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-amino-N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]butanamide;dihydrochloride |
| SMILES | CC(N)CC(=O)NCc1ccc(Oc2cccc(F)c2)nc1.Cl.Cl |
| InChI | InChI=1S/C16H18FN3O2.2ClH/c1-11(18)7-15(21)19-9-12-5-6-16(20-10-12)22-14-4-2-3-13(17)8-14;;/h2-6,8,10-11H,7,9,18H2,1H3,(H,19,21);2*1H |
| InChIKey | OJDJEIZWTSLPPJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |