C19H16FN3O4 — CID 51130463
N-[2-[[6-(3-fluorophenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]furan-3-carboxamide (PubChem CID 51130463) has the molecular formula C19H16FN3O4 and a molecular weight of 369.35 g/mol. Its IUPAC name is N-[2-[[6-(3-fluorophenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]furan-3-carboxamide.
| Compound Name | N-[2-[[6-(3-fluorophenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 51130463 |
| Molecular Formula | C19H16FN3O4 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[2-[[6-(3-fluorophenoxy)-3-pyridinyl]methylamino]-2-oxoethyl]furan-3-carboxamide |
| SMILES | O=C(CNC(=O)c1ccoc1)NCc1ccc(Oc2cccc(F)c2)nc1 |
| InChI | InChI=1S/C19H16FN3O4/c20-15-2-1-3-16(8-15)27-18-5-4-13(10-22-18)9-21-17(24)11-23-19(25)14-6-7-26-12-14/h1-8,10,12H,9,11H2,(H,21,24)(H,23,25) |
| InChIKey | WUWQPWNGBUOUPJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |