C19H18FN3O2S — CID 60610907
1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-thiophen-2-ylethyl)urea (PubChem CID 60610907) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 60610907 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cccs1)NCc1ccc(Oc2cccc(F)c2)nc1 |
| InChI | InChI=1S/C19H18FN3O2S/c20-15-3-1-4-16(11-15)25-18-7-6-14(12-22-18)13-23-19(24)21-9-8-17-5-2-10-26-17/h1-7,10-12H,8-9,13H2,(H2,21,23,24) |
| InChIKey | ASTSFQSRXRJKDJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |