C21H17F4N3O2 — CID 56545552
N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56545552) has the molecular formula C21H17F4N3O2 and a molecular weight of 419.38 g/mol. Its IUPAC name is N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56545552 |
| Molecular Formula | C21H17F4N3O2 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)NCc1ccc(Oc2cccc(F)c2)nc1 |
| InChI | InChI=1S/C21H17F4N3O2/c22-16-4-2-6-18(10-16)30-20-8-7-14(12-28-20)11-27-19(29)13-26-17-5-1-3-15(9-17)21(23,24)25/h1-10,12,26H,11,13H2,(H,27,29) |
| InChIKey | NYRNDSKLJKLLPY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |