C20H23F3N2O3 — CID 56553002
N-[(3-methoxy-4-propoxyphenyl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56553002) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is N-[(3-methoxy-4-propoxyphenyl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56553002 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[(3-methoxy-4-propoxyphenyl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CCCOc1ccc(CNC(=O)CNc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C20H23F3N2O3/c1-3-9-28-17-8-7-14(10-18(17)27-2)12-25-19(26)13-24-16-6-4-5-15(11-16)20(21,22)23/h4-8,10-11,24H,3,9,12-13H2,1-2H3,(H,25,26) |
| InChIKey | VJOGNVPRUIBREE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |