C19H23N3O4 — CID 109003188
2-(3-acetamidoanilino)-N-[(3,4-dimethoxyphenyl)methyl]acetamide (PubChem CID 109003188) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(3-acetamidoanilino)-N-[(3,4-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3-acetamidoanilino)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 109003188 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-(3-acetamidoanilino)-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CNc2cccc(NC(C)=O)c2)cc1OC |
| InChI | InChI=1S/C19H23N3O4/c1-13(23)22-16-6-4-5-15(10-16)20-12-19(24)21-11-14-7-8-17(25-2)18(9-14)26-3/h4-10,20H,11-12H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | GXUDYAFJVSMUDV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |