C19H25Cl2N3O3 — CID 119847592
N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119847592) has the molecular formula C19H25Cl2N3O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119847592 |
| Molecular Formula | C19H25Cl2N3O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[[6-(3-methoxyphenoxy)-3-pyridinyl]methyl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | COc1cccc(Oc2ccc(CNC(=O)C3CCCNC3)cn2)c1.Cl.Cl |
| InChI | InChI=1S/C19H23N3O3.2ClH/c1-24-16-5-2-6-17(10-16)25-18-8-7-14(11-21-18)12-22-19(23)15-4-3-9-20-13-15;;/h2,5-8,10-11,15,20H,3-4,9,12-13H2,1H3,(H,22,23);2*1H |
| InChIKey | IVFGNHAQWGZNFY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |