C21H25N3O4 — CID 55857997
N-[4-[[6-(3-methoxyphenoxy)-3-pyridinyl]methylamino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 55857997) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[4-[[6-(3-methoxyphenoxy)-3-pyridinyl]methylamino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[6-(3-methoxyphenoxy)-3-pyridinyl]methylamino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 55857997 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[4-[[6-(3-methoxyphenoxy)-3-pyridinyl]methylamino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | COc1cccc(Oc2ccc(CNC(=O)CCCNC(=O)C3CC3)cn2)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-17-4-2-5-18(12-17)28-20-10-7-15(14-24-20)13-23-19(25)6-3-11-22-21(26)16-8-9-16/h2,4-5,7,10,12,14,16H,3,6,8-9,11,13H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | VRBVMZSBOLNXNC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|