C21H24N4O3 — CID 119872975
N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119872975) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119872975 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1cccc(Oc2ccc(NC(=O)C3CC4CCCCC4N3)cn2)c1 |
| InChI | InChI=1S/C21H24N4O3/c22-20(26)14-5-3-6-16(10-14)28-19-9-8-15(12-23-19)24-21(27)18-11-13-4-1-2-7-17(13)25-18/h3,5-6,8-10,12-13,17-18,25H,1-2,4,7,11H2,(H2,22,26)(H,24,27) |
| InChIKey | PDMLFCWTPOEWBI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |