C21H28Cl2N4O3 — CID 119872984
3-[[5-(3-piperidin-4-ylbutanoylamino)-2-pyridinyl]oxy]benzamide;dihydrochloride (PubChem CID 119872984) has the molecular formula C21H28Cl2N4O3 and a molecular weight of 455.39 g/mol. Its IUPAC name is 3-[[5-(3-piperidin-4-ylbutanoylamino)-2-pyridinyl]oxy]benzamide;dihydrochloride.
| Compound Name | 3-[[5-(3-piperidin-4-ylbutanoylamino)-2-pyridinyl]oxy]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119872984 |
| Molecular Formula | C21H28Cl2N4O3 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-[[5-(3-piperidin-4-ylbutanoylamino)-2-pyridinyl]oxy]benzamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1ccc(Oc2cccc(C(N)=O)c2)nc1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C21H26N4O3.2ClH/c1-14(15-7-9-23-10-8-15)11-19(26)25-17-5-6-20(24-13-17)28-18-4-2-3-16(12-18)21(22)27;;/h2-6,12-15,23H,7-11H2,1H3,(H2,22,27)(H,25,26);2*1H |
| InChIKey | XBVVMWCWAWDUAM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |