C22H28ClN3O3 — CID 119779665
3-[4-(3-piperidin-4-ylbutanoylamino)phenoxy]benzamide;hydrochloride (PubChem CID 119779665) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 3-[4-(3-piperidin-4-ylbutanoylamino)phenoxy]benzamide;hydrochloride.
| Compound Name | 3-[4-(3-piperidin-4-ylbutanoylamino)phenoxy]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119779665 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-[4-(3-piperidin-4-ylbutanoylamino)phenoxy]benzamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccc(Oc2cccc(C(N)=O)c2)cc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C22H27N3O3.ClH/c1-15(16-9-11-24-12-10-16)13-21(26)25-18-5-7-19(8-6-18)28-20-4-2-3-17(14-20)22(23)27;/h2-8,14-16,24H,9-13H2,1H3,(H2,23,27)(H,25,26);1H |
| InChIKey | BZCZJOGRCZFOQJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |