C18H20N4O3 — CID 119872961
N-[6-(3-carbamoylphenoxy)-3-pyridinyl]piperidine-3-carboxamide (PubChem CID 119872961) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[6-(3-carbamoylphenoxy)-3-pyridinyl]piperidine-3-carboxamide.
| Compound Name | N-[6-(3-carbamoylphenoxy)-3-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119872961 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[6-(3-carbamoylphenoxy)-3-pyridinyl]piperidine-3-carboxamide |
| SMILES | NC(=O)c1cccc(Oc2ccc(NC(=O)C3CCCNC3)cn2)c1 |
| InChI | InChI=1S/C18H20N4O3/c19-17(23)12-3-1-5-15(9-12)25-16-7-6-14(11-21-16)22-18(24)13-4-2-8-20-10-13/h1,3,5-7,9,11,13,20H,2,4,8,10H2,(H2,19,23)(H,22,24) |
| InChIKey | HVVWMZIKTJFSRA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |