C21H31ClN4O2 — CID 119300488
N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119300488) has the molecular formula C21H31ClN4O2 and a molecular weight of 406.96 g/mol. Its IUPAC name is N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119300488 |
| Molecular Formula | C21H31ClN4O2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCc1cccc(NC(=O)N2CCCC2)c1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C21H30N4O2.ClH/c26-20(19-13-16-7-1-2-9-18(16)24-19)22-14-15-6-5-8-17(12-15)23-21(27)25-10-3-4-11-25;/h5-6,8,12,16,18-19,24H,1-4,7,9-11,13-14H2,(H,22,26)(H,23,27);1H |
| InChIKey | ALFRLOQVTPUYQC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |