C22H34Cl2N4O2 — CID 119899026
N-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119899026) has the molecular formula C22H34Cl2N4O2 and a molecular weight of 457.45 g/mol. Its IUPAC name is N-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119899026 |
| Molecular Formula | C22H34Cl2N4O2 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CN1CCN(C(=O)Cc2cccc(NC(=O)C3CC4CCCCC4N3)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H32N4O2.2ClH/c1-25-9-11-26(12-10-25)21(27)14-16-5-4-7-18(13-16)23-22(28)20-15-17-6-2-3-8-19(17)24-20;;/h4-5,7,13,17,19-20,24H,2-3,6,8-12,14-15H2,1H3,(H,23,28);2*1H |
| InChIKey | VEZBCJMMVXNYLJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |