C22H35Cl2N3O — CID 119836209
N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119836209) has the molecular formula C22H35Cl2N3O and a molecular weight of 428.45 g/mol. Its IUPAC name is N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119836209 |
| Molecular Formula | C22H35Cl2N3O |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCc1ccc(CN2CCCCC2)cc1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C22H33N3O.2ClH/c26-22(21-14-19-6-2-3-7-20(19)24-21)23-15-17-8-10-18(11-9-17)16-25-12-4-1-5-13-25;;/h8-11,19-21,24H,1-7,12-16H2,(H,23,26);2*1H |
| InChIKey | XQZREWBWUCCDPH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |