C23H37Cl2N3O2 — CID 119865523
N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119865523) has the molecular formula C23H37Cl2N3O2 and a molecular weight of 458.47 g/mol. Its IUPAC name is N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119865523 |
| Molecular Formula | C23H37Cl2N3O2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | COc1ccc(CN2CCC(CNC(=O)C3CC4CCCCC4N3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C23H35N3O2.2ClH/c1-28-20-8-6-18(7-9-20)16-26-12-10-17(11-13-26)15-24-23(27)22-14-19-4-2-3-5-21(19)25-22;;/h6-9,17,19,21-22,25H,2-5,10-16H2,1H3,(H,24,27);2*1H |
| InChIKey | OYLTZMDOCSQORI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |