C17H21F3N2O — CID 119275113
N-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119275113) has the molecular formula C17H21F3N2O and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119275113 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[[4-(trifluoromethyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C17H21F3N2O/c18-17(19,20)13-7-5-11(6-8-13)10-21-16(23)15-9-12-3-1-2-4-14(12)22-15/h5-8,12,14-15,22H,1-4,9-10H2,(H,21,23) |
| InChIKey | VHQOGQOBXKADDI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |