C21H31ClN4O2 — CID 119313008
4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide;hydrochloride (PubChem CID 119313008) has the molecular formula C21H31ClN4O2 and a molecular weight of 406.96 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide;hydrochloride.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119313008 |
| Molecular Formula | C21H31ClN4O2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide;hydrochloride |
| SMILES | Cc1cccc(NC(=O)N2CCN(C(=O)C3CC4CCCCC4N3)CC2)c1.Cl |
| InChI | InChI=1S/C21H30N4O2.ClH/c1-15-5-4-7-17(13-15)22-21(27)25-11-9-24(10-12-25)20(26)19-14-16-6-2-3-8-18(16)23-19;/h4-5,7,13,16,18-19,23H,2-3,6,8-12,14H2,1H3,(H,22,27);1H |
| InChIKey | RIFFJUUTVIMDFE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |