C22H32N4O2 — CID 120988658
4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 120988658) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 120988658 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 4-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCN(C(=O)C3CC4CCCC(C3)C4N)CC2)c1 |
| InChI | InChI=1S/C22H32N4O2/c1-15-4-2-7-19(12-15)24-22(28)26-10-8-25(9-11-26)21(27)18-13-16-5-3-6-17(14-18)20(16)23/h2,4,7,12,16-18,20H,3,5-6,8-11,13-14,23H2,1H3,(H,24,28) |
| InChIKey | ZSDDONOZGDINEU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |