C19H23N3O3 — CID 119847892
N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]piperidine-2-carboxamide (PubChem CID 119847892) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]piperidine-2-carboxamide.
| Compound Name | N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119847892 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[[2-(4-methoxyphenoxy)-4-pyridinyl]methyl]piperidine-2-carboxamide |
| SMILES | COc1ccc(Oc2cc(CNC(=O)C3CCCCN3)ccn2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-24-15-5-7-16(8-6-15)25-18-12-14(9-11-21-18)13-22-19(23)17-4-2-3-10-20-17/h5-9,11-12,17,20H,2-4,10,13H2,1H3,(H,22,23) |
| InChIKey | NHUQXTQNFYKQIF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |