C11H23N3O3S2 — CID 82908390
N-[3-[ethyl(methylsulfonyl)amino]propyl]thiomorpholine-3-carboxamide (PubChem CID 82908390) has the molecular formula C11H23N3O3S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908390 |
| Molecular Formula | C11H23N3O3S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]thiomorpholine-3-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CSCCN1)S(C)(=O)=O |
| InChI | InChI=1S/C11H23N3O3S2/c1-3-14(19(2,16)17)7-4-5-13-11(15)10-9-18-8-6-12-10/h10,12H,3-9H2,1-2H3,(H,13,15) |
| InChIKey | JOPMIIUNZNKYDL-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|