C10H21N3OS — CID 24692990
N-[2-(diethylamino)ethyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 24692990) has the molecular formula C10H21N3OS and a molecular weight of 231.36 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 24692990 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)C1CSCN1 |
| InChI | InChI=1S/C10H21N3OS/c1-3-13(4-2)6-5-11-10(14)9-7-15-8-12-9/h9,12H,3-8H2,1-2H3,(H,11,14) |
| InChIKey | ORNVEMIYMWRXPU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |