C9H18N2O3S — CID 82908917
N-[2-(2-hydroxyethoxy)ethyl]thiomorpholine-3-carboxamide (PubChem CID 82908917) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908917 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]thiomorpholine-3-carboxamide |
| SMILES | O=C(NCCOCCO)C1CSCCN1 |
| InChI | InChI=1S/C9H18N2O3S/c12-3-5-14-4-1-11-9(13)8-7-15-6-2-10-8/h8,10,12H,1-7H2,(H,11,13) |
| InChIKey | ZHOXBFQMLLLMMG-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|