C8H13F3N2OS2 — CID 106428279
N-[2-(trifluoromethylsulfanyl)ethyl]thiomorpholine-3-carboxamide (PubChem CID 106428279) has the molecular formula C8H13F3N2OS2 and a molecular weight of 274.33 g/mol. Its IUPAC name is N-[2-(trifluoromethylsulfanyl)ethyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[2-(trifluoromethylsulfanyl)ethyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 106428279 |
| Molecular Formula | C8H13F3N2OS2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-[2-(trifluoromethylsulfanyl)ethyl]thiomorpholine-3-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)C1CSCCN1 |
| InChI | InChI=1S/C8H13F3N2OS2/c9-8(10,11)16-4-2-13-7(14)6-5-15-3-1-12-6/h6,12H,1-5H2,(H,13,14) |
| InChIKey | MIRVLCJAPJQZOB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|