C8H12F4N2OS — CID 106291830
N-(2,2,3,3-tetrafluoropropyl)thiomorpholine-3-carboxamide (PubChem CID 106291830) has the molecular formula C8H12F4N2OS and a molecular weight of 260.26 g/mol. Its IUPAC name is N-(2,2,3,3-tetrafluoropropyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(2,2,3,3-tetrafluoropropyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 106291830 |
| Molecular Formula | C8H12F4N2OS |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-(2,2,3,3-tetrafluoropropyl)thiomorpholine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)F)C1CSCCN1 |
| InChI | InChI=1S/C8H12F4N2OS/c9-7(10)8(11,12)4-14-6(15)5-3-16-2-1-13-5/h5,7,13H,1-4H2,(H,14,15) |
| InChIKey | PKWIZAXKWLPQBF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|