C8H16N2OS2 — CID 82917884
N-(2-methylsulfanylethyl)thiomorpholine-3-carboxamide (PubChem CID 82917884) has the molecular formula C8H16N2OS2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(2-methylsulfanylethyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82917884 |
| Molecular Formula | C8H16N2OS2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | N-(2-methylsulfanylethyl)thiomorpholine-3-carboxamide |
| SMILES | CSCCNC(=O)C1CSCCN1 |
| InChI | InChI=1S/C8H16N2OS2/c1-12-4-2-10-8(11)7-6-13-5-3-9-7/h7,9H,2-6H2,1H3,(H,10,11) |
| InChIKey | MMNYZJGSLIPABS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|