C13H18N2OS2 — CID 82908901
N-(2-phenylsulfanylethyl)thiomorpholine-3-carboxamide (PubChem CID 82908901) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(2-phenylsulfanylethyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908901 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-(2-phenylsulfanylethyl)thiomorpholine-3-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)C1CSCCN1 |
| InChI | InChI=1S/C13H18N2OS2/c16-13(12-10-17-8-6-14-12)15-7-9-18-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2,(H,15,16) |
| InChIKey | ZOLCZVXQHTXYNA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|