C9H18N2OS2 — CID 82917885
N-(3-methylsulfanylpropyl)thiomorpholine-3-carboxamide (PubChem CID 82917885) has the molecular formula C9H18N2OS2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(3-methylsulfanylpropyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82917885 |
| Molecular Formula | C9H18N2OS2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-(3-methylsulfanylpropyl)thiomorpholine-3-carboxamide |
| SMILES | CSCCCNC(=O)C1CSCCN1 |
| InChI | InChI=1S/C9H18N2OS2/c1-13-5-2-3-11-9(12)8-7-14-6-4-10-8/h8,10H,2-7H2,1H3,(H,11,12) |
| InChIKey | XFJJMDXZFJTKTL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|