C7H15N3OS — CID 82908482
N-(2-aminoethyl)thiomorpholine-3-carboxamide (PubChem CID 82908482) has the molecular formula C7H15N3OS and a molecular weight of 189.28 g/mol. Its IUPAC name is N-(2-aminoethyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82908482 |
| Molecular Formula | C7H15N3OS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-(2-aminoethyl)thiomorpholine-3-carboxamide |
| SMILES | NCCNC(=O)C1CSCCN1 |
| InChI | InChI=1S/C7H15N3OS/c8-1-2-10-7(11)6-5-12-4-3-9-6/h6,9H,1-5,8H2,(H,10,11) |
| InChIKey | HOXUCCNVGXIRJC-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |