C12H22N2O2S — CID 106135048
N-[(3-hydroxycyclohexyl)methyl]thiomorpholine-3-carboxamide (PubChem CID 106135048) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 106135048 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]thiomorpholine-3-carboxamide |
| SMILES | O=C(NCC1CCCC(O)C1)C1CSCCN1 |
| InChI | InChI=1S/C12H22N2O2S/c15-10-3-1-2-9(6-10)7-14-12(16)11-8-17-5-4-13-11/h9-11,13,15H,1-8H2,(H,14,16) |
| InChIKey | AHYMKYOCQYXXBT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |