C10H13F7N2O — CID 106293083
N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)piperidine-2-carboxamide (PubChem CID 106293083) has the molecular formula C10H13F7N2O and a molecular weight of 310.21 g/mol. Its IUPAC name is N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)piperidine-2-carboxamide.
| Compound Name | N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 106293083 |
| Molecular Formula | C10H13F7N2O |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-(2,2,3,3-tetrafluoropropyl)-5-(trifluoromethyl)piperidine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)F)C1CCC(C(F)(F)F)CN1 |
| InChI | InChI=1S/C10H13F7N2O/c11-8(12)9(13,14)4-19-7(20)6-2-1-5(3-18-6)10(15,16)17/h5-6,8,18H,1-4H2,(H,19,20) |
| InChIKey | CNBODCPMJDSMCM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|