C13H22F3N3O2 — CID 114908559
N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)piperidine-2-carboxamide (PubChem CID 114908559) has the molecular formula C13H22F3N3O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)piperidine-2-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114908559 |
| Molecular Formula | C13H22F3N3O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)piperidine-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1CCC(C(F)(F)F)CN1 |
| InChI | InChI=1S/C13H22F3N3O2/c14-13(15,16)10-1-2-11(18-9-10)12(20)17-3-4-19-5-7-21-8-6-19/h10-11,18H,1-9H2,(H,17,20) |
| InChIKey | BSBWOTCLULGLTG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |