C15H19F3N2O — CID 114908570
N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)piperidine-2-carboxamide (PubChem CID 114908570) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)piperidine-2-carboxamide.
| Compound Name | N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114908570 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-5-(trifluoromethyl)piperidine-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCC(C(F)(F)F)CN2)cc1 |
| InChI | InChI=1S/C15H19F3N2O/c1-10-2-4-11(5-3-10)8-20-14(21)13-7-6-12(9-19-13)15(16,17)18/h2-5,12-13,19H,6-9H2,1H3,(H,20,21) |
| InChIKey | PEKNPWNESUWWIA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |