C8H13F3N2OS — CID 103795366
(2R)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 103795366) has the molecular formula C8H13F3N2OS and a molecular weight of 242.27 g/mol. Its IUPAC name is (2R)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103795366 |
| Molecular Formula | C8H13F3N2OS |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (2R)-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)[C@H]1CCCN1 |
| InChI | InChI=1S/C8H13F3N2OS/c9-8(10,11)15-5-4-13-7(14)6-2-1-3-12-6/h6,12H,1-5H2,(H,13,14)/t6-/m1/s1 |
| InChIKey | GDFHPFMTCPUTNF-ZCFIWIBFSA-N |
| XLogP | 1.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|