C14H26N4O2S2 — CID 11725207
(2S)-N-[2-[2-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyldisulfanyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 11725207) has the molecular formula C14H26N4O2S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (2S)-N-[2-[2-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyldisulfanyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-[2-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyldisulfanyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11725207 |
| Molecular Formula | C14H26N4O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2S)-N-[2-[2-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyldisulfanyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCSSCCNC(=O)[C@@H]1CCCN1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C14H26N4O2S2/c19-13(11-3-1-5-15-11)17-7-9-21-22-10-8-18-14(20)12-4-2-6-16-12/h11-12,15-16H,1-10H2,(H,17,19)(H,18,20)/t11-,12-/m0/s1 |
| InChIKey | UCLNFVOYTBITCJ-RYUDHWBXSA-N |
| XLogP | 0.10 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|