C6H13BN2O3 — CID 74765706
[[(2S)-pyrrolidine-2-carbonyl]amino]methylboronic acid (PubChem CID 74765706) has the molecular formula C6H13BN2O3 and a molecular weight of 171.99 g/mol. Its IUPAC name is [[(2S)-pyrrolidine-2-carbonyl]amino]methylboronic acid.
| Compound Name | [[(2S)-pyrrolidine-2-carbonyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 74765706 |
| Molecular Formula | C6H13BN2O3 |
| Molecular Weight | 171.99 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | [[(2S)-pyrrolidine-2-carbonyl]amino]methylboronic acid |
| SMILES | O=C(NCB(O)O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C6H13BN2O3/c10-6(9-4-7(11)12)5-2-1-3-8-5/h5,8,11-12H,1-4H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | CPGOUBHEEBIJAM-YFKPBYRVSA-N |
| XLogP | -2.13 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.99 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|