C7H13N3O2 — CID 18324145
N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide (PubChem CID 18324145) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18324145 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | N-(2-amino-2-oxoethyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CNC(=O)C1CCCN1 |
| InChI | InChI=1S/C7H13N3O2/c8-6(11)4-10-7(12)5-2-1-3-9-5/h5,9H,1-4H2,(H2,8,11)(H,10,12) |
| InChIKey | MZKZJHTZJCEFKZ-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |