C9H16N4O3 — CID 66887574
(2R)-N-[2-[(2-aminoacetyl)amino]-2-oxoethyl]pyrrolidine-2-carboxamide (PubChem CID 66887574) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is (2R)-N-[2-[(2-aminoacetyl)amino]-2-oxoethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-[(2-aminoacetyl)amino]-2-oxoethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66887574 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (2R)-N-[2-[(2-aminoacetyl)amino]-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES | NCC(=O)NC(=O)CNC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H16N4O3/c10-4-7(14)13-8(15)5-12-9(16)6-2-1-3-11-6/h6,11H,1-5,10H2,(H,12,16)(H,13,14,15)/t6-/m1/s1 |
| InChIKey | IZIQKGZACARMIO-ZCFIWIBFSA-N |
| XLogP | -2.54 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |