C11H22ClN3O2 — CID 119272921
(2S)-N-[2-(tert-butylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119272921) has the molecular formula C11H22ClN3O2 and a molecular weight of 263.77 g/mol. Its IUPAC name is (2S)-N-[2-(tert-butylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[2-(tert-butylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119272921 |
| Molecular Formula | C11H22ClN3O2 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (2S)-N-[2-(tert-butylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CC(C)(C)NC(=O)CNC(=O)[C@@H]1CCCN1.Cl |
| InChI | InChI=1S/C11H21N3O2.ClH/c1-11(2,3)14-9(15)7-13-10(16)8-5-4-6-12-8;/h8,12H,4-7H2,1-3H3,(H,13,16)(H,14,15);1H/t8-;/m0./s1 |
| InChIKey | PHDFARUYDBINCU-QRPNPIFTSA-N |
| XLogP | 0.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |