(2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen

C7H18N2O — CID 178045420

IUPAC(2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen
SMILESCCNC(=O)[C@H]1CCCN1.[H][H].[H][H]
InChIInChI=1S/C7H14N2O.2H2/c1-2-8-7(10)6-4-3-5-9-6;;/h6,9H,2-5H2,1H3,(H,8,10);2*1H/t6-;;/m1../s1
InChIKeyCXKDFWCPRSLQPA-QYCVXMPOSA-N
MW146.23 g/mol
LogP0.37
Rot. Bonds2

About (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen

(2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen (PubChem CID 178045420) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen.

Molecular Properties

Compound Name(2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen
PubChem CID178045420
Molecular FormulaC7H18N2O
Molecular Weight146.23 g/mol
Exact Mass146.14
IUPAC Name(2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen
SMILESCCNC(=O)[C@H]1CCCN1.[H][H].[H][H]
InChIInChI=1S/C7H14N2O.2H2/c1-2-8-7(10)6-4-3-5-9-6;;/h6,9H,2-5H2,1H3,(H,8,10);2*1H/t6-;;/m1../s1
InChIKeyCXKDFWCPRSLQPA-QYCVXMPOSA-N
XLogP0.37
TPSA41.13 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.23
LogP ≤ 50.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen?
The IUPAC name of (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen (CID 178045420) is (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen.
What is the SMILES notation for (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen?
The canonical SMILES for (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen is CCNC(=O)[C@H]1CCCN1.[H][H].[H][H].
What is the InChIKey of (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen?
The InChIKey is CXKDFWCPRSLQPA-QYCVXMPOSA-N. The full InChI is InChI=1S/C7H14N2O.2H2/c1-2-8-7(10)6-4-3-5-9-6;;/h6,9H,2-5H2,1H3,(H,8,10);2*1H/t6-;;/m1../s1.
What are the key properties of (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen?
(2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen has a molecular weight of 146.23 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-ethylpyrrolidine-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 178045420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).