C20H36N4O — CID 159949991
CID 159949991 (PubChem CID 159949991) has the molecular formula C20H36N4O and a molecular weight of 348.54 g/mol.
| Compound Name | CID 159949991 |
|---|---|
| PubChem CID | 159949991 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | — |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CCNC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H22N2.C7H14N2O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-2-8-7(10)6-4-3-5-9-6/h12-13H,1-10H2;6,9H,2-5H2,1H3,(H,8,10)/t;6-/m.0/s1 |
| InChIKey | OBZFMMDKHGDYRW-ZCMDIHMWSA-N |
| XLogP | 3.70 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|