C13H25N3O2 — CID 64564235
N-[2-(2-methylpropanoylamino)ethyl]azepane-2-carboxamide (PubChem CID 64564235) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-[2-(2-methylpropanoylamino)ethyl]azepane-2-carboxamide.
| Compound Name | N-[2-(2-methylpropanoylamino)ethyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 64564235 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N-[2-(2-methylpropanoylamino)ethyl]azepane-2-carboxamide |
| SMILES | CC(C)C(=O)NCCNC(=O)C1CCCCCN1 |
| InChI | InChI=1S/C13H25N3O2/c1-10(2)12(17)15-8-9-16-13(18)11-6-4-3-5-7-14-11/h10-11,14H,3-9H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | LWNNIDJJXBRRJH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|