C11H22N2O2 — CID 103810229
(2S)-N-(3-hydroxypentyl)piperidine-2-carboxamide (PubChem CID 103810229) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2S)-N-(3-hydroxypentyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(3-hydroxypentyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 103810229 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (2S)-N-(3-hydroxypentyl)piperidine-2-carboxamide |
| SMILES | CCC(O)CCNC(=O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C11H22N2O2/c1-2-9(14)6-8-13-11(15)10-5-3-4-7-12-10/h9-10,12,14H,2-8H2,1H3,(H,13,15)/t9?,10-/m0/s1 |
| InChIKey | YQTDQPNHHLEVAR-AXDSSHIGSA-N |
| XLogP | 0.41 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |