C9H19N3O3S — CID 103796458
(2R)-N-[2-(ethylsulfamoyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 103796458) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is (2R)-N-[2-(ethylsulfamoyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(ethylsulfamoyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103796458 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (2R)-N-[2-(ethylsulfamoyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H19N3O3S/c1-2-12-16(14,15)7-6-11-9(13)8-4-3-5-10-8/h8,10,12H,2-7H2,1H3,(H,11,13)/t8-/m1/s1 |
| InChIKey | VFQUNCFCVADRQG-MRVPVSSYSA-N |
| XLogP | -1.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |